C30H29N3O9 — CID 71712501
[(2R,3R,4S,5S,6S)-6-(3-azidopropoxy)-4,5-dibenzoyloxy-2-(hydroxymethyl)oxan-3-yl] benzoate (PubChem CID 71712501) has the molecular formula C30H29N3O9 and a molecular weight of 575.57 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-6-(3-azidopropoxy)-4,5-dibenzoyloxy-2-(hydroxymethyl)oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-6-(3-azidopropoxy)-4,5-dibenzoyloxy-2-(hydroxymethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 71712501 |
| Molecular Formula | C30H29N3O9 |
| Molecular Weight | 575.57 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-6-(3-azidopropoxy)-4,5-dibenzoyloxy-2-(hydroxymethyl)oxan-3-yl] benzoate |
| SMILES | [N-]=[N+]=NCCCO[C@H]1O[C@H](CO)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H29N3O9/c31-33-32-17-10-18-38-30-26(42-29(37)22-15-8-3-9-16-22)25(41-28(36)21-13-6-2-7-14-21)24(23(19-34)39-30)40-27(35)20-11-4-1-5-12-20/h1-9,11-16,23-26,30,34H,10,17-19H2/t23-,24-,25+,26+,30+/m1/s1 |
| InChIKey | VGVAPHPEVBTAQK-PWVMNMNYSA-N |
| XLogP | 4.10 |
| TPSA | 166.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|