C33H38O10Si — CID 10746466
[(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(2-trimethylsilylethoxy)oxan-3-yl] 4-methoxybenzoate (PubChem CID 10746466) has the molecular formula C33H38O10Si and a molecular weight of 622.74 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(2-trimethylsilylethoxy)oxan-3-yl] 4-methoxybenzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(2-trimethylsilylethoxy)oxan-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 10746466 |
| Molecular Formula | C33H38O10Si |
| Molecular Weight | 622.74 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(2-trimethylsilylethoxy)oxan-3-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@H]2[C@H](OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OCC[Si](C)(C)C)O[C@@H]2CO)cc1 |
| InChI | InChI=1S/C33H38O10Si/c1-38-25-17-15-24(16-18-25)32(37)41-27-26(21-34)40-33(39-19-20-44(2,3)4)29(43-31(36)23-13-9-6-10-14-23)28(27)42-30(35)22-11-7-5-8-12-22/h5-18,26-29,33-34H,19-21H2,1-4H3/t26-,27-,28+,29-,33-/m1/s1 |
| InChIKey | LSCHHUFDPSTKPF-CLFGJDMISA-N |
| XLogP | 4.74 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|