C32H36O8Si — CID 101273321
[(2S,3S,4R,5S,6R)-4,5-dibenzoyloxy-6-(hydroxymethyl)-2-(2-trimethylsilylethyl)oxan-3-yl] benzoate (PubChem CID 101273321) has the molecular formula C32H36O8Si and a molecular weight of 576.72 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-4,5-dibenzoyloxy-6-(hydroxymethyl)-2-(2-trimethylsilylethyl)oxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5S,6R)-4,5-dibenzoyloxy-6-(hydroxymethyl)-2-(2-trimethylsilylethyl)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 101273321 |
| Molecular Formula | C32H36O8Si |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-4,5-dibenzoyloxy-6-(hydroxymethyl)-2-(2-trimethylsilylethyl)oxan-3-yl] benzoate |
| SMILES | C[Si](C)(C)CC[C@@H]1O[C@H](CO)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H36O8Si/c1-41(2,3)20-19-25-27(38-30(34)22-13-7-4-8-14-22)29(40-32(36)24-17-11-6-12-18-24)28(26(21-33)37-25)39-31(35)23-15-9-5-10-16-23/h4-18,25-29,33H,19-21H2,1-3H3/t25-,26+,27-,28-,29+/m0/s1 |
| InChIKey | MTASCNFOAROVTF-UCWKTGAJSA-N |
| XLogP | 5.15 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|