C14H18O4 — CID 59911969
[(2R,3S,4S,5S)-2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl] benzoate (PubChem CID 59911969) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,4S,5S)-2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 59911969 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [(2R,3S,4S,5S)-2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl] benzoate |
| SMILES | C[C@@H]1[C@H](OC(=O)c2ccccc2)[C@@H](CO)O[C@H]1C |
| InChI | InChI=1S/C14H18O4/c1-9-10(2)17-12(8-15)13(9)18-14(16)11-6-4-3-5-7-11/h3-7,9-10,12-13,15H,8H2,1-2H3/t9-,10-,12+,13-/m0/s1 |
| InChIKey | PMNJDYHJURXEJS-DJIHRAIXSA-N |
| XLogP | 1.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |