C33H32O10 — CID 167099106
[(2S,3S,4S,5R,6S)-4,5-dibenzoyloxy-6-(hydroxymethyl)-2-[(E)-5-methoxy-5-oxopent-3-enyl]oxan-3-yl] benzoate (PubChem CID 167099106) has the molecular formula C33H32O10 and a molecular weight of 588.61 g/mol. Its IUPAC name is [(2S,3S,4S,5R,6S)-4,5-dibenzoyloxy-6-(hydroxymethyl)-2-[(E)-5-methoxy-5-oxopent-3-enyl]oxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4S,5R,6S)-4,5-dibenzoyloxy-6-(hydroxymethyl)-2-[(E)-5-methoxy-5-oxopent-3-enyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 167099106 |
| Molecular Formula | C33H32O10 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | [(2S,3S,4S,5R,6S)-4,5-dibenzoyloxy-6-(hydroxymethyl)-2-[(E)-5-methoxy-5-oxopent-3-enyl]oxan-3-yl] benzoate |
| SMILES | COC(=O)/C=C/CC[C@@H]1O[C@@H](CO)[C@@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H32O10/c1-39-27(35)20-12-11-19-25-28(41-31(36)22-13-5-2-6-14-22)30(43-33(38)24-17-9-4-10-18-24)29(26(21-34)40-25)42-32(37)23-15-7-3-8-16-23/h2-10,12-18,20,25-26,28-30,34H,11,19,21H2,1H3/b20-12+/t25-,26-,28-,29+,30-/m0/s1 |
| InChIKey | MAQOKNWIISDGOT-UIUFSTKMSA-N |
| XLogP | 3.93 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|