C18H18O6 — CID 131964383
[(6S)-6-[(E)-5-methoxy-5-oxopent-3-enyl]-5-oxo-2H-pyran-2-yl] benzoate (PubChem CID 131964383) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is [(6S)-6-[(E)-5-methoxy-5-oxopent-3-enyl]-5-oxo-2H-pyran-2-yl] benzoate.
| Compound Name | [(6S)-6-[(E)-5-methoxy-5-oxopent-3-enyl]-5-oxo-2H-pyran-2-yl] benzoate |
|---|---|
| PubChem CID | 131964383 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [(6S)-6-[(E)-5-methoxy-5-oxopent-3-enyl]-5-oxo-2H-pyran-2-yl] benzoate |
| SMILES | COC(=O)/C=C/CC[C@@H]1OC(OC(=O)c2ccccc2)C=CC1=O |
| InChI | InChI=1S/C18H18O6/c1-22-16(20)10-6-5-9-15-14(19)11-12-17(23-15)24-18(21)13-7-3-2-4-8-13/h2-4,6-8,10-12,15,17H,5,9H2,1H3/b10-6+/t15-,17?/m0/s1 |
| InChIKey | ISPQKNSJZIEAKA-CFMCVEOWSA-N |
| XLogP | 2.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|