C18H24O3 — CID 90364561
[(2S,3R,5R)-2-[(Z)-hex-3-enyl]-5-methyloxolan-3-yl] benzoate (PubChem CID 90364561) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is [(2S,3R,5R)-2-[(Z)-hex-3-enyl]-5-methyloxolan-3-yl] benzoate.
| Compound Name | [(2S,3R,5R)-2-[(Z)-hex-3-enyl]-5-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90364561 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | [(2S,3R,5R)-2-[(Z)-hex-3-enyl]-5-methyloxolan-3-yl] benzoate |
| SMILES | CC/C=C\CC[C@@H]1O[C@H](C)C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H24O3/c1-3-4-5-9-12-16-17(13-14(2)20-16)21-18(19)15-10-7-6-8-11-15/h4-8,10-11,14,16-17H,3,9,12-13H2,1-2H3/b5-4-/t14-,16+,17-/m1/s1 |
| InChIKey | HHKJJCIFKLYAEP-SOKBFDDESA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|