C31H36O5 — CID 101060917
[(1R,2R,3R,4S)-4-benzoyloxy-3-(hydroxymethyl)-2-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]cyclopentyl] benzoate (PubChem CID 101060917) has the molecular formula C31H36O5 and a molecular weight of 488.62 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-4-benzoyloxy-3-(hydroxymethyl)-2-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]cyclopentyl] benzoate.
| Compound Name | [(1R,2R,3R,4S)-4-benzoyloxy-3-(hydroxymethyl)-2-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]cyclopentyl] benzoate |
|---|---|
| PubChem CID | 101060917 |
| Molecular Formula | C31H36O5 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [(1R,2R,3R,4S)-4-benzoyloxy-3-(hydroxymethyl)-2-[(2Z,5Z,8Z)-undeca-2,5,8-trienyl]cyclopentyl] benzoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C[C@@H]1[C@H](CO)[C@@H](OC(=O)c2ccccc2)C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H36O5/c1-2-3-4-5-6-7-8-9-16-21-26-27(23-32)29(36-31(34)25-19-14-11-15-20-25)22-28(26)35-30(33)24-17-12-10-13-18-24/h3-4,6-7,9-20,26-29,32H,2,5,8,21-23H2,1H3/b4-3-,7-6-,16-9-/t26-,27+,28-,29+/m1/s1 |
| InChIKey | DWXCVLRDKLGFGB-BQCGHCCESA-N |
| XLogP | 6.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|