C26H26O7 — CID 10742183
[(1R,2R,3S,4S)-4-benzoyloxy-3-formyl-2-[(Z)-5-methoxy-5-oxopent-2-enyl]cyclopentyl] benzoate (PubChem CID 10742183) has the molecular formula C26H26O7 and a molecular weight of 450.49 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-4-benzoyloxy-3-formyl-2-[(Z)-5-methoxy-5-oxopent-2-enyl]cyclopentyl] benzoate.
| Compound Name | [(1R,2R,3S,4S)-4-benzoyloxy-3-formyl-2-[(Z)-5-methoxy-5-oxopent-2-enyl]cyclopentyl] benzoate |
|---|---|
| PubChem CID | 10742183 |
| Molecular Formula | C26H26O7 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | [(1R,2R,3S,4S)-4-benzoyloxy-3-formyl-2-[(Z)-5-methoxy-5-oxopent-2-enyl]cyclopentyl] benzoate |
| SMILES | COC(=O)C/C=C\C[C@@H]1[C@H](C=O)[C@@H](OC(=O)c2ccccc2)C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H26O7/c1-31-24(28)15-9-8-14-20-21(17-27)23(33-26(30)19-12-6-3-7-13-19)16-22(20)32-25(29)18-10-4-2-5-11-18/h2-13,17,20-23H,14-16H2,1H3/b9-8-/t20-,21+,22-,23+/m1/s1 |
| InChIKey | GKBIBBHNDZNRAT-BXZRPMHZSA-N |
| XLogP | 3.78 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|