C33H44O7 — CID 10674270
[(1R,2R,3S,4S)-4-benzoyloxy-3-(3-hydroxyoctyl)-2-(5-methoxy-5-oxopentyl)cyclopentyl] benzoate (PubChem CID 10674270) has the molecular formula C33H44O7 and a molecular weight of 552.71 g/mol. Its IUPAC name is [(1R,2R,3S,4S)-4-benzoyloxy-3-(3-hydroxyoctyl)-2-(5-methoxy-5-oxopentyl)cyclopentyl] benzoate.
| Compound Name | [(1R,2R,3S,4S)-4-benzoyloxy-3-(3-hydroxyoctyl)-2-(5-methoxy-5-oxopentyl)cyclopentyl] benzoate |
|---|---|
| PubChem CID | 10674270 |
| Molecular Formula | C33H44O7 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.31 |
| IUPAC Name | [(1R,2R,3S,4S)-4-benzoyloxy-3-(3-hydroxyoctyl)-2-(5-methoxy-5-oxopentyl)cyclopentyl] benzoate |
| SMILES | CCCCCC(O)CC[C@H]1[C@@H](CCCCC(=O)OC)[C@H](OC(=O)c2ccccc2)C[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H44O7/c1-3-4-7-18-26(34)21-22-28-27(19-12-13-20-31(35)38-2)29(39-32(36)24-14-8-5-9-15-24)23-30(28)40-33(37)25-16-10-6-11-17-25/h5-6,8-11,14-17,26-30,34H,3-4,7,12-13,18-23H2,1-2H3/t26?,27-,28+,29-,30+/m1/s1 |
| InChIKey | VIXJLRQONLVUPG-KXCDBBNJSA-N |
| XLogP | 6.53 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|