About methyl 6-benzylundecanoate
methyl 6-benzylundecanoate (PubChem CID 58960739) has the molecular formula C19H30O2
and a molecular weight of 290.45 g/mol. Its IUPAC name is methyl 6-benzylundecanoate.
Molecular Properties
| Compound Name | methyl 6-benzylundecanoate |
| PubChem CID | 58960739 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | methyl 6-benzylundecanoate |
| SMILES | CCCCCC(CCCCC(=O)OC)Cc1ccccc1 |
| InChI | InChI=1S/C19H30O2/c1-3-4-6-11-17(14-9-10-15-19(20)21-2)16-18-12-7-5-8-13-18/h5,7-8,12-13,17H,3-4,6,9-11,14-16H2,1-2H3 |
| InChIKey | IJAUOZJUTSGUCT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-benzylundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-benzylundecanoate?
The IUPAC name of methyl 6-benzylundecanoate (CID 58960739) is methyl 6-benzylundecanoate.
What is the SMILES notation for methyl 6-benzylundecanoate?
The canonical SMILES for methyl 6-benzylundecanoate is CCCCCC(CCCCC(=O)OC)Cc1ccccc1.
What is the InChIKey of methyl 6-benzylundecanoate?
The InChIKey is IJAUOZJUTSGUCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O2/c1-3-4-6-11-17(14-9-10-15-19(20)21-2)16-18-12-7-5-8-13-18/h5,7-8,12-13,17H,3-4,6,9-11,14-16H2,1-2H3.
What are the key properties of methyl 6-benzylundecanoate?
methyl 6-benzylundecanoate has a molecular weight of 290.45 g/mol, XLogP of 5.16, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-benzylundecanoate is sourced from PubChem (CID 58960739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).