About 4-benzyldodecanoic acid;N-methylmethanamine
4-benzyldodecanoic acid;N-methylmethanamine (PubChem CID 138628491) has the molecular formula C21H37NO2
and a molecular weight of 335.53 g/mol. Its IUPAC name is 4-benzyldodecanoic acid;N-methylmethanamine.
Molecular Properties
| Compound Name | 4-benzyldodecanoic acid;N-methylmethanamine |
| PubChem CID | 138628491 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | 4-benzyldodecanoic acid;N-methylmethanamine |
| SMILES | CCCCCCCCC(CCC(=O)O)Cc1ccccc1.CNC |
| InChI | InChI=1S/C19H30O2.C2H7N/c1-2-3-4-5-6-8-13-18(14-15-19(20)21)16-17-11-9-7-10-12-17;1-3-2/h7,9-12,18H,2-6,8,13-16H2,1H3,(H,20,21);3H,1-2H3 |
| InChIKey | GZSFELYDYYXZAE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyldodecanoic acid;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyldodecanoic acid;N-methylmethanamine?
The IUPAC name of 4-benzyldodecanoic acid;N-methylmethanamine (CID 138628491) is 4-benzyldodecanoic acid;N-methylmethanamine.
What is the SMILES notation for 4-benzyldodecanoic acid;N-methylmethanamine?
The canonical SMILES for 4-benzyldodecanoic acid;N-methylmethanamine is CCCCCCCCC(CCC(=O)O)Cc1ccccc1.CNC.
What is the InChIKey of 4-benzyldodecanoic acid;N-methylmethanamine?
The InChIKey is GZSFELYDYYXZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O2.C2H7N/c1-2-3-4-5-6-8-13-18(14-15-19(20)21)16-17-11-9-7-10-12-17;1-3-2/h7,9-12,18H,2-6,8,13-16H2,1H3,(H,20,21);3H,1-2H3.
What are the key properties of 4-benzyldodecanoic acid;N-methylmethanamine?
4-benzyldodecanoic acid;N-methylmethanamine has a molecular weight of 335.53 g/mol, XLogP of 5.30, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyldodecanoic acid;N-methylmethanamine is sourced from PubChem (CID 138628491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).