C25H38O4 — CID 70621342
methyl (Z)-7-[1-hydroxy-3-(3-hydroxyoctyl)-2,3-dihydro-1H-inden-2-yl]hept-5-enoate (PubChem CID 70621342) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is methyl (Z)-7-[1-hydroxy-3-(3-hydroxyoctyl)-2,3-dihydro-1H-inden-2-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[1-hydroxy-3-(3-hydroxyoctyl)-2,3-dihydro-1H-inden-2-yl]hept-5-enoate |
|---|---|
| PubChem CID | 70621342 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | methyl (Z)-7-[1-hydroxy-3-(3-hydroxyoctyl)-2,3-dihydro-1H-inden-2-yl]hept-5-enoate |
| SMILES | CCCCCC(O)CCC1c2ccccc2C(O)C1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C25H38O4/c1-3-4-7-12-19(26)17-18-21-20-13-10-11-15-22(20)25(28)23(21)14-8-5-6-9-16-24(27)29-2/h5,8,10-11,13,15,19,21,23,25-26,28H,3-4,6-7,9,12,14,16-18H2,1-2H3/b8-5- |
| InChIKey | DLHVLVNKRJMVIV-YVMONPNESA-N |
| XLogP | 5.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|