C26H40O5 — CID 21057375
propyl (E)-7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate (PubChem CID 21057375) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is propyl (E)-7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate.
| Compound Name | propyl (E)-7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 21057375 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | propyl (E)-7-[3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoate |
| SMILES | CCCOC(=O)CCC/C=C/CC1C(O)CC(O)C1CCC(O)CCc1ccccc1 |
| InChI | InChI=1S/C26H40O5/c1-2-18-31-26(30)13-9-4-3-8-12-22-23(25(29)19-24(22)28)17-16-21(27)15-14-20-10-6-5-7-11-20/h3,5-8,10-11,21-25,27-29H,2,4,9,12-19H2,1H3/b8-3+ |
| InChIKey | SZYSLDNDQCUMDJ-FPYGCLRLSA-N |
| XLogP | 4.19 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|