C31H43NO8 — CID 70669118
[2-[(dihydroxyamino)oxymethyl]phenyl]methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 70669118) has the molecular formula C31H43NO8 and a molecular weight of 557.68 g/mol. Its IUPAC name is [2-[(dihydroxyamino)oxymethyl]phenyl]methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | [2-[(dihydroxyamino)oxymethyl]phenyl]methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70669118 |
| Molecular Formula | C31H43NO8 |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | [2-[(dihydroxyamino)oxymethyl]phenyl]methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O)OCc1ccccc1CON(O)O |
| InChI | InChI=1S/C31H43NO8/c33-26(17-16-23-10-4-3-5-11-23)18-19-28-27(29(34)20-30(28)35)14-6-1-2-7-15-31(36)39-21-24-12-8-9-13-25(24)22-40-32(37)38/h1,3-6,8-13,26-30,33-35,37-38H,2,7,14-22H2/b6-1-/t26-,27+,28+,29-,30+/m0/s1 |
| InChIKey | HRJNIGKIBOMIKR-UZPPQERISA-N |
| XLogP | 4.49 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|