C33H46N2O9 — CID 89069056
[3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]acetate (PubChem CID 89069056) has the molecular formula C33H46N2O9 and a molecular weight of 614.74 g/mol. Its IUPAC name is [3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]acetate.
| Compound Name | [3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]acetate |
|---|---|
| PubChem CID | 89069056 |
| Molecular Formula | C33H46N2O9 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.32 |
| IUPAC Name | [3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]acetate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O)NCC(=O)OCc1cccc(CON(O)O)c1 |
| InChI | InChI=1S/C33H46N2O9/c36-27(16-15-24-9-4-3-5-10-24)17-18-29-28(30(37)20-31(29)38)13-6-1-2-7-14-32(39)34-21-33(40)43-22-25-11-8-12-26(19-25)23-44-35(41)42/h1,3-6,8-12,19,27-31,36-38,41-42H,2,7,13-18,20-23H2,(H,34,39)/b6-1-/t27-,28+,29+,30-,31+/m0/s1 |
| InChIKey | LGYCSLFWFUXBJT-LMYWGGTMSA-N |
| XLogP | 3.61 |
| TPSA | 169.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|