C23H36Cl2O5 — CID 138503362
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoic acid;dihydrochloride (PubChem CID 138503362) has the molecular formula C23H36Cl2O5 and a molecular weight of 463.44 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoic acid;dihydrochloride.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoic acid;dihydrochloride |
|---|---|
| PubChem CID | 138503362 |
| Molecular Formula | C23H36Cl2O5 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-hydroxy-5-phenylpentyl)cyclopentyl]hept-5-enoic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)CCCC=CC[C@@H]1[C@@H](CCC(O)CCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H34O5.2ClH/c24-18(13-12-17-8-4-3-5-9-17)14-15-20-19(21(25)16-22(20)26)10-6-1-2-7-11-23(27)28;;/h1,3-6,8-9,18-22,24-26H,2,7,10-16H2,(H,27,28);2*1H/t18?,19-,20-,21+,22-;;/m1../s1 |
| InChIKey | QGPWWFNPYJPPGB-YVHRPREWSA-N |
| XLogP | 4.16 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|