C35H38O9 — CID 118634037
[3,5-di(prop-2-ynoyloxy)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 118634037) has the molecular formula C35H38O9 and a molecular weight of 602.68 g/mol. Its IUPAC name is [3,5-di(prop-2-ynoyloxy)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | [3,5-di(prop-2-ynoyloxy)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 118634037 |
| Molecular Formula | C35H38O9 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | [3,5-di(prop-2-ynoyloxy)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | C#CC(=O)Oc1cc(OC(=O)C#C)cc(OC(=O)CCC/C=C\C[C@@H]2[C@@H](CC[C@@H](O)CCc3ccccc3)[C@H](O)C[C@@H]2O)c1 |
| InChI | InChI=1S/C35H38O9/c1-3-33(39)42-26-20-27(43-34(40)4-2)22-28(21-26)44-35(41)15-11-6-5-10-14-29-30(32(38)23-31(29)37)19-18-25(36)17-16-24-12-8-7-9-13-24/h1-2,5,7-10,12-13,20-22,25,29-32,36-38H,6,11,14-19,23H2/b10-5-/t25-,29+,30+,31-,32+/m0/s1 |
| InChIKey | ZQIPXZLWKTUIDV-JEQLNXLCSA-N |
| XLogP | 3.92 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|