C29H46O5 — CID 90821985
propan-2-yl 7-[(1R,2R)-3,5-dihydroxy-2-(3-hydroxy-8-phenyloctyl)cyclopentyl]hept-5-enoate (PubChem CID 90821985) has the molecular formula C29H46O5 and a molecular weight of 474.68 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2R)-3,5-dihydroxy-2-(3-hydroxy-8-phenyloctyl)cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(1R,2R)-3,5-dihydroxy-2-(3-hydroxy-8-phenyloctyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90821985 |
| Molecular Formula | C29H46O5 |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | propan-2-yl 7-[(1R,2R)-3,5-dihydroxy-2-(3-hydroxy-8-phenyloctyl)cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CC[C@H]1C(O)CC(O)[C@@H]1CCC(O)CCCCCc1ccccc1 |
| InChI | InChI=1S/C29H46O5/c1-22(2)34-29(33)18-12-4-3-11-17-25-26(28(32)21-27(25)31)20-19-24(30)16-10-6-9-15-23-13-7-5-8-14-23/h3,5,7-8,11,13-14,22,24-28,30-32H,4,6,9-10,12,15-21H2,1-2H3/t24?,25-,26-,27?,28?/m1/s1 |
| InChIKey | ZMGGTYOMHWMASL-HKZOZJMOSA-N |
| XLogP | 5.36 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|