C28H44O3 — CID 70958049
propan-2-yl (Z)-7-[(1S,2R,3R,5S)-3-hydroxy-5-methyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 70958049) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1S,2R,3R,5S)-3-hydroxy-5-methyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1S,2R,3R,5S)-3-hydroxy-5-methyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70958049 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | propan-2-yl (Z)-7-[(1S,2R,3R,5S)-3-hydroxy-5-methyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](C)CCc2ccccc2)[C@H](O)C[C@@H]1C |
| InChI | InChI=1S/C28H44O3/c1-21(2)31-28(30)15-11-6-5-10-14-25-23(4)20-27(29)26(25)19-17-22(3)16-18-24-12-8-7-9-13-24/h5,7-10,12-13,21-23,25-27,29H,6,11,14-20H2,1-4H3/b10-5-/t22-,23-,25-,26+,27+/m0/s1 |
| InChIKey | FVHNKXBYLLEPKI-IDKVKOMQSA-N |
| XLogP | 6.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|