C29H48O2 — CID 118530939
propan-2-yl 7-[(1S,2S,3R,5S)-3,5-dimethyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]heptanoate (PubChem CID 118530939) has the molecular formula C29H48O2 and a molecular weight of 428.70 g/mol. Its IUPAC name is propan-2-yl 7-[(1S,2S,3R,5S)-3,5-dimethyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]heptanoate.
| Compound Name | propan-2-yl 7-[(1S,2S,3R,5S)-3,5-dimethyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 118530939 |
| Molecular Formula | C29H48O2 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.37 |
| IUPAC Name | propan-2-yl 7-[(1S,2S,3R,5S)-3,5-dimethyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]heptanoate |
| SMILES | CC(C)OC(=O)CCCCCC[C@@H]1[C@@H](CC[C@@H](C)CCc2ccccc2)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C29H48O2/c1-22(2)31-29(30)16-12-7-6-11-15-27-24(4)21-25(5)28(27)20-18-23(3)17-19-26-13-9-8-10-14-26/h8-10,13-14,22-25,27-28H,6-7,11-12,15-21H2,1-5H3/t23-,24-,25+,27-,28-/m0/s1 |
| InChIKey | CLICQDMHTQRCEQ-WHOBFWAKSA-N |
| XLogP | 8.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|