C29H46O2 — CID 70958041
propan-2-yl (Z)-7-[(1S,2S,3R,5S)-3,5-dimethyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 70958041) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1S,2S,3R,5S)-3,5-dimethyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1S,2S,3R,5S)-3,5-dimethyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70958041 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | propan-2-yl (Z)-7-[(1S,2S,3R,5S)-3,5-dimethyl-2-[(3R)-3-methyl-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](C)CCc2ccccc2)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C29H46O2/c1-22(2)31-29(30)16-12-7-6-11-15-27-24(4)21-25(5)28(27)20-18-23(3)17-19-26-13-9-8-10-14-26/h6,8-11,13-14,22-25,27-28H,7,12,15-21H2,1-5H3/b11-6-/t23-,24-,25+,27-,28-/m0/s1 |
| InChIKey | JTIWRIIQRAESKG-NMIWRVFSSA-N |
| XLogP | 8.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|