C44H82O5Si3 — CID 171042383
propan-2-yl (E)-7-[(1R,2R,3R,5S)-2-[(3R)-5-phenyl-3-triethylsilyloxypentyl]-3,5-bis(triethylsilyloxy)cyclopentyl]hept-5-enoate (PubChem CID 171042383) has the molecular formula C44H82O5Si3 and a molecular weight of 775.39 g/mol. Its IUPAC name is propan-2-yl (E)-7-[(1R,2R,3R,5S)-2-[(3R)-5-phenyl-3-triethylsilyloxypentyl]-3,5-bis(triethylsilyloxy)cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (E)-7-[(1R,2R,3R,5S)-2-[(3R)-5-phenyl-3-triethylsilyloxypentyl]-3,5-bis(triethylsilyloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 171042383 |
| Molecular Formula | C44H82O5Si3 |
| Molecular Weight | 775.39 g/mol |
| Exact Mass | 774.55 |
| IUPAC Name | propan-2-yl (E)-7-[(1R,2R,3R,5S)-2-[(3R)-5-phenyl-3-triethylsilyloxypentyl]-3,5-bis(triethylsilyloxy)cyclopentyl]hept-5-enoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](CCc1ccccc1)CC[C@@H]1[C@@H](C/C=C/CCCC(=O)OC(C)C)[C@@H](O[Si](CC)(CC)CC)C[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C44H82O5Si3/c1-12-50(13-2,14-3)47-39(33-32-38-28-24-23-25-29-38)34-35-41-40(30-26-21-22-27-31-44(45)46-37(10)11)42(48-51(15-4,16-5)17-6)36-43(41)49-52(18-7,19-8)20-9/h21,23-26,28-29,37,39-43H,12-20,22,27,30-36H2,1-11H3/b26-21+/t39-,40+,41+,42-,43+/m0/s1 |
| InChIKey | BDKOEHDXBRAVIY-SWHDIGPHSA-N |
| XLogP | 13.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.39 |
| LogP ≤ 5 | 13.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|