C33H50O9 — CID 70913363
4-O-(1,3-dihydroxypropan-2-yl) 1-O-[(3R)-1-[(1R,2R,3S)-3-hydroxy-2-[(Z)-7-oxo-7-propan-2-yloxyhept-2-enyl]cyclopentyl]-5-phenylpentan-3-yl] butanedioate (PubChem CID 70913363) has the molecular formula C33H50O9 and a molecular weight of 590.75 g/mol. Its IUPAC name is 4-O-(1,3-dihydroxypropan-2-yl) 1-O-[(3R)-1-[(1R,2R,3S)-3-hydroxy-2-[(Z)-7-oxo-7-propan-2-yloxyhept-2-enyl]cyclopentyl]-5-phenylpentan-3-yl] butanedioate.
| Compound Name | 4-O-(1,3-dihydroxypropan-2-yl) 1-O-[(3R)-1-[(1R,2R,3S)-3-hydroxy-2-[(Z)-7-oxo-7-propan-2-yloxyhept-2-enyl]cyclopentyl]-5-phenylpentan-3-yl] butanedioate |
|---|---|
| PubChem CID | 70913363 |
| Molecular Formula | C33H50O9 |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | 4-O-(1,3-dihydroxypropan-2-yl) 1-O-[(3R)-1-[(1R,2R,3S)-3-hydroxy-2-[(Z)-7-oxo-7-propan-2-yloxyhept-2-enyl]cyclopentyl]-5-phenylpentan-3-yl] butanedioate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@H](CCc2ccccc2)OC(=O)CCC(=O)OC(CO)CO)CC[C@@H]1O |
| InChI | InChI=1S/C33H50O9/c1-24(2)40-31(37)13-9-4-3-8-12-29-26(16-19-30(29)36)15-18-27(17-14-25-10-6-5-7-11-25)41-32(38)20-21-33(39)42-28(22-34)23-35/h3,5-8,10-11,24,26-30,34-36H,4,9,12-23H2,1-2H3/b8-3-/t26-,27-,29+,30-/m0/s1 |
| InChIKey | LYSQIWWBGPZPQA-ROFJKPHLSA-N |
| XLogP | 4.44 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|