C30H44N6O6 — CID 118634061
propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(3R)-3-[3-azido-2-(azidomethyl)propanoyl]oxy-5-phenylpentyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 118634061) has the molecular formula C30H44N6O6 and a molecular weight of 584.72 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(3R)-3-[3-azido-2-(azidomethyl)propanoyl]oxy-5-phenylpentyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(3R)-3-[3-azido-2-(azidomethyl)propanoyl]oxy-5-phenylpentyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 118634061 |
| Molecular Formula | C30H44N6O6 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-2-[(3R)-3-[3-azido-2-(azidomethyl)propanoyl]oxy-5-phenylpentyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@H](CCc2ccccc2)OC(=O)C(CN=[N+]=[N-])CN=[N+]=[N-])[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C30H44N6O6/c1-21(2)41-29(39)13-9-4-3-8-12-25-26(28(38)18-27(25)37)17-16-24(15-14-22-10-6-5-7-11-22)42-30(40)23(19-33-35-31)20-34-36-32/h3,5-8,10-11,21,23-28,37-38H,4,9,12-20H2,1-2H3/b8-3-/t24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | HJUZWPGDKQGVIA-DDLINBTOSA-N |
| XLogP | 5.97 |
| TPSA | 190.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|