C23H35O5P — CID 91159489
7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-5-phenyl-3-phosphanyloxypentyl]cyclopentyl]hept-5-enoic acid (PubChem CID 91159489) has the molecular formula C23H35O5P and a molecular weight of 422.50 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-5-phenyl-3-phosphanyloxypentyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-5-phenyl-3-phosphanyloxypentyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91159489 |
| Molecular Formula | C23H35O5P |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-5-phenyl-3-phosphanyloxypentyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H](CC[C@H](CCc2ccccc2)OP)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H35O5P/c24-21-16-22(25)20(19(21)10-6-1-2-7-11-23(26)27)15-14-18(28-29)13-12-17-8-4-3-5-9-17/h1,3-6,8-9,18-22,24-25H,2,7,10-16,29H2,(H,26,27)/t18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | GJESBEIFGVPOEU-AHJNKEMKSA-N |
| XLogP | 4.13 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|