C18H33O5P — CID 90717045
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-phosphanyloxyhexyl]cyclopentyl]hept-5-enoic acid (PubChem CID 90717045) has the molecular formula C18H33O5P and a molecular weight of 360.43 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-phosphanyloxyhexyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-phosphanyloxyhexyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 90717045 |
| Molecular Formula | C18H33O5P |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-phosphanyloxyhexyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCC[C@@H](CC[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O)OP |
| InChI | InChI=1S/C18H33O5P/c1-2-7-13(23-24)10-11-15-14(16(19)12-17(15)20)8-5-3-4-6-9-18(21)22/h3,5,13-17,19-20H,2,4,6-12,24H2,1H3,(H,21,22)/b5-3-/t13-,14+,15+,16-,17+/m0/s1 |
| InChIKey | NHQASWPBVAPKOS-KXBARXQLSA-N |
| XLogP | 3.30 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|