C22H33ClO6P2 — CID 91238946
7-[(1R,2R)-2-[4-(3-chlorophenoxy)-3-phosphanyloxybutyl]-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid (PubChem CID 91238946) has the molecular formula C22H33ClO6P2 and a molecular weight of 490.90 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[4-(3-chlorophenoxy)-3-phosphanyloxybutyl]-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[4-(3-chlorophenoxy)-3-phosphanyloxybutyl]-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91238946 |
| Molecular Formula | C22H33ClO6P2 |
| Molecular Weight | 490.90 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 7-[(1R,2R)-2-[4-(3-chlorophenoxy)-3-phosphanyloxybutyl]-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1C(O)CC(OP)[C@@H]1CCC(COc1cccc(Cl)c1)OP |
| InChI | InChI=1S/C22H33ClO6P2/c23-15-6-5-7-16(12-15)27-14-17(28-30)10-11-19-18(20(24)13-21(19)29-31)8-3-1-2-4-9-22(25)26/h1,3,5-7,12,17-21,24H,2,4,8-11,13-14,30-31H2,(H,25,26)/t17?,18-,19-,20?,21?/m1/s1 |
| InChIKey | LGNRTYXTXLMHOD-VAOVLXHWSA-N |
| XLogP | 5.05 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|