C27H40O7 — CID 70549129
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-(oxan-2-yloxy)-4-phenoxybutyl]cyclopentyl]hept-5-enoic acid (PubChem CID 70549129) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-(oxan-2-yloxy)-4-phenoxybutyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-(oxan-2-yloxy)-4-phenoxybutyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70549129 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3S)-3-(oxan-2-yloxy)-4-phenoxybutyl]cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](COc2ccccc2)OC2CCCCO2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H40O7/c28-24-18-25(29)23(22(24)12-6-1-2-7-13-26(30)31)16-15-21(34-27-14-8-9-17-32-27)19-33-20-10-4-3-5-11-20/h1,3-6,10-11,21-25,27-29H,2,7-9,12-19H2,(H,30,31)/b6-1-/t21-,22+,23+,24-,25+,27?/m0/s1 |
| InChIKey | RMNNKWDWQYFVQE-FEYZILFKSA-N |
| XLogP | 4.32 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|