C25H36O6 — CID 13218612
(Z)-7-[(1S,2R,3R,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-(phenylmethoxymethyl)cyclopentyl]hept-5-enoic acid (PubChem CID 13218612) has the molecular formula C25H36O6 and a molecular weight of 432.56 g/mol. Its IUPAC name is (Z)-7-[(1S,2R,3R,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-(phenylmethoxymethyl)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R,3R,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-(phenylmethoxymethyl)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 13218612 |
| Molecular Formula | C25H36O6 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (Z)-7-[(1S,2R,3R,5R)-5-hydroxy-3-(oxan-2-yloxy)-2-(phenylmethoxymethyl)cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@H](COCc2ccccc2)[C@H](OC2CCCCO2)C[C@H]1O |
| InChI | InChI=1S/C25H36O6/c26-22-16-23(31-25-14-8-9-15-30-25)21(18-29-17-19-10-4-3-5-11-19)20(22)12-6-1-2-7-13-24(27)28/h1,3-6,10-11,20-23,25-26H,2,7-9,12-18H2,(H,27,28)/b6-1-/t20-,21-,22+,23+,25?/m0/s1 |
| InChIKey | BIYXVDOQJCJFOG-WKGSLTBKSA-N |
| XLogP | 4.31 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|