C21H34O7 — CID 57264714
7-[(1R,2R,3R,5S)-5-hydroxy-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 57264714) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-5-hydroxy-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-5-hydroxy-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57264714 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-5-hydroxy-2-[(4R)-2-methyl-1,3-dioxolan-4-yl]-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | CC1OC[C@@H]([C@@H]2[C@@H](CC=CCCCC(=O)O)[C@@H](O)C[C@H]2OC2CCCCO2)O1 |
| InChI | InChI=1S/C21H34O7/c1-14-26-13-18(27-14)21-15(8-4-2-3-5-9-19(23)24)16(22)12-17(21)28-20-10-6-7-11-25-20/h2,4,14-18,20-22H,3,5-13H2,1H3,(H,23,24)/t14?,15-,16-,17+,18-,20?,21+/m0/s1 |
| InChIKey | VIONPPNCKPOJOT-FMEAGORQSA-N |
| XLogP | 2.86 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|