C29H51O7Si — CID 86757020
CID 86757020 (PubChem CID 86757020) has the molecular formula C29H51O7Si and a molecular weight of 539.81 g/mol.
| Compound Name | CID 86757020 |
|---|---|
| PubChem CID | 86757020 |
| Molecular Formula | C29H51O7Si |
| Molecular Weight | 539.81 g/mol |
| Exact Mass | 539.34 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC([C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1)C(C)(C)C |
| InChI | InChI=1S/C29H51O7Si/c1-29(2,3)28(36-37(4)5)27-21(14-8-6-7-9-15-24(30)31)22(34-25-16-10-12-18-32-25)20-23(27)35-26-17-11-13-19-33-26/h6,8,21-23,25-28H,7,9-20H2,1-5H3,(H,30,31)/b8-6-/t21-,22-,23+,25?,26?,27-,28?/m0/s1 |
| InChIKey | LHIDJHITKFKTNC-NONIZBDQSA-N |
| XLogP | 6.33 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.81 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|