C26H46O7Si — CID 173366025
(Z)-7-[5-acetyloxy-2-(2-tert-butylsilyloxypropan-2-yl)-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 173366025) has the molecular formula C26H46O7Si and a molecular weight of 498.73 g/mol. Its IUPAC name is (Z)-7-[5-acetyloxy-2-(2-tert-butylsilyloxypropan-2-yl)-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[5-acetyloxy-2-(2-tert-butylsilyloxypropan-2-yl)-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 173366025 |
| Molecular Formula | C26H46O7Si |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (Z)-7-[5-acetyloxy-2-(2-tert-butylsilyloxypropan-2-yl)-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | CC(=O)OC1CC(OC2CCCCO2)C(C(C)(C)O[SiH2]C(C)(C)C)C1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C26H46O7Si/c1-18(27)31-20-17-21(32-23-15-11-12-16-30-23)24(26(5,6)33-34-25(2,3)4)19(20)13-9-7-8-10-14-22(28)29/h7,9,19-21,23-24H,8,10-17,34H2,1-6H3,(H,28,29)/b9-7- |
| InChIKey | VULZMJBGKFUKEM-CLFYSBASSA-N |
| XLogP | 4.76 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|