C27H48O6Si — CID 173040304
prop-2-enyl 7-[(1R,2S,3R,5S)-2-(2-tert-butylsilyloxypropan-2-yl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 173040304) has the molecular formula C27H48O6Si and a molecular weight of 496.76 g/mol. Its IUPAC name is prop-2-enyl 7-[(1R,2S,3R,5S)-2-(2-tert-butylsilyloxypropan-2-yl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | prop-2-enyl 7-[(1R,2S,3R,5S)-2-(2-tert-butylsilyloxypropan-2-yl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 173040304 |
| Molecular Formula | C27H48O6Si |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | prop-2-enyl 7-[(1R,2S,3R,5S)-2-(2-tert-butylsilyloxypropan-2-yl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | C=CCOC(=O)CCCC=CC[C@@H]1[C@H](C(C)(C)O[SiH2]C(C)(C)C)[C@H](OC2CCCCO2)C[C@@H]1O |
| InChI | InChI=1S/C27H48O6Si/c1-7-17-30-23(29)15-11-9-8-10-14-20-21(28)19-22(32-24-16-12-13-18-31-24)25(20)27(5,6)33-34-26(2,3)4/h7-8,10,20-22,24-25,28H,1,9,11-19,34H2,2-6H3/t20-,21-,22+,24?,25-/m0/s1 |
| InChIKey | VZBDZDHOKRLODU-KQCMGBNBSA-N |
| XLogP | 4.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|