C26H42F2O5 — CID 68865978
methyl 7-[(1R,2R,3R,5S)-2-(3,3-difluorooct-1-enyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 68865978) has the molecular formula C26H42F2O5 and a molecular weight of 472.61 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-2-(3,3-difluorooct-1-enyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-2-(3,3-difluorooct-1-enyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 68865978 |
| Molecular Formula | C26H42F2O5 |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-2-(3,3-difluorooct-1-enyl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC(F)(F)C=C[C@@H]1[C@@H](CC=CCCCC(=O)OC)[C@@H](O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C26H42F2O5/c1-3-4-10-16-26(27,28)17-15-21-20(12-7-5-6-8-13-24(30)31-2)22(29)19-23(21)33-25-14-9-11-18-32-25/h5,7,15,17,20-23,25,29H,3-4,6,8-14,16,18-19H2,1-2H3/t20-,21-,22+,23-,25?/m1/s1 |
| InChIKey | XODQIXZYSAZXGE-JVGOVNBASA-N |
| XLogP | 5.96 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|