C25H40F2O4 — CID 89187817
(Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluorooct-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enal (PubChem CID 89187817) has the molecular formula C25H40F2O4 and a molecular weight of 442.59 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluorooct-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enal.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluorooct-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enal |
|---|---|
| PubChem CID | 89187817 |
| Molecular Formula | C25H40F2O4 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluorooct-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-5-enal |
| SMILES | CCCCCC(F)(F)/C=C/[C@@H]1[C@@H](C/C=C\CCCC=O)[C@@H](O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C25H40F2O4/c1-2-3-9-15-25(26,27)16-14-21-20(12-7-5-4-6-10-17-28)22(29)19-23(21)31-24-13-8-11-18-30-24/h5,7,14,16-17,20-24,29H,2-4,6,8-13,15,18-19H2,1H3/b7-5-,16-14+/t20-,21-,22+,23-,24?/m1/s1 |
| InChIKey | ZAMNWWHUTFSHAH-GSNQCVADSA-N |
| XLogP | 5.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|