C34H56O7 — CID 15518062
(Z)-6-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hex-4-enal (PubChem CID 15518062) has the molecular formula C34H56O7 and a molecular weight of 576.82 g/mol. Its IUPAC name is (Z)-6-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hex-4-enal.
| Compound Name | (Z)-6-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hex-4-enal |
|---|---|
| PubChem CID | 15518062 |
| Molecular Formula | C34H56O7 |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.40 |
| IUPAC Name | (Z)-6-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hex-4-enal |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCC=O)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C34H56O7/c1-2-3-6-15-27(39-32-17-8-12-23-36-32)20-21-29-28(16-7-4-5-11-22-35)30(40-33-18-9-13-24-37-33)26-31(29)41-34-19-10-14-25-38-34/h4,7,20-22,27-34H,2-3,5-6,8-19,23-26H2,1H3/b7-4-,21-20+/t27-,28+,29+,30-,31+,32?,33?,34?/m0/s1 |
| InChIKey | HXYWRSPKZQLZRR-INZDTZSJSA-N |
| XLogP | 7.42 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|