C39H66O8 — CID 70570234
[(Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enyl] 2-methylpropanoate (PubChem CID 70570234) has the molecular formula C39H66O8 and a molecular weight of 662.95 g/mol. Its IUPAC name is [(Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enyl] 2-methylpropanoate.
| Compound Name | [(Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 70570234 |
| Molecular Formula | C39H66O8 |
| Molecular Weight | 662.95 g/mol |
| Exact Mass | 662.48 |
| IUPAC Name | [(Z)-7-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enyl] 2-methylpropanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCCOC(=O)C(C)C)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C39H66O8/c1-4-5-9-18-31(45-36-20-11-15-25-41-36)23-24-33-32(19-10-7-6-8-14-28-44-39(40)30(2)3)34(46-37-21-12-16-26-42-37)29-35(33)47-38-22-13-17-27-43-38/h7,10,23-24,30-38H,4-6,8-9,11-22,25-29H2,1-3H3/b10-7-,24-23+/t31-,32+,33+,34-,35+,36?,37?,38?/m0/s1 |
| InChIKey | GHJFUBIMULOJJR-AZIWLJIISA-N |
| XLogP | 8.81 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.95 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|