C38H64O8 — CID 57081316
8-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]oct-6-en-2-yl acetate (PubChem CID 57081316) has the molecular formula C38H64O8 and a molecular weight of 648.92 g/mol. Its IUPAC name is 8-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]oct-6-en-2-yl acetate.
| Compound Name | 8-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]oct-6-en-2-yl acetate |
|---|---|
| PubChem CID | 57081316 |
| Molecular Formula | C38H64O8 |
| Molecular Weight | 648.92 g/mol |
| Exact Mass | 648.46 |
| IUPAC Name | 8-[(1R,2R,3R,5S)-3,5-bis(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]oct-6-en-2-yl acetate |
| SMILES | CCCCC[C@@H](C=C[C@@H]1[C@@H](CC=CCCCC(C)OC(C)=O)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C38H64O8/c1-4-5-8-18-31(44-36-20-11-14-25-40-36)23-24-33-32(19-10-7-6-9-17-29(2)43-30(3)39)34(45-37-21-12-15-26-41-37)28-35(33)46-38-22-13-16-27-42-38/h7,10,23-24,29,31-38H,4-6,8-9,11-22,25-28H2,1-3H3/t29?,31-,32+,33+,34-,35+,36?,37?,38?/m0/s1 |
| InChIKey | ZYQDISSZCVCZRE-UEPZUXRQSA-N |
| XLogP | 8.56 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.92 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|