C32H55NO7 — CID 57146715
7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enyl N-methylcarbamate (PubChem CID 57146715) has the molecular formula C32H55NO7 and a molecular weight of 565.79 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enyl N-methylcarbamate.
| Compound Name | 7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enyl N-methylcarbamate |
|---|---|
| PubChem CID | 57146715 |
| Molecular Formula | C32H55NO7 |
| Molecular Weight | 565.79 g/mol |
| Exact Mass | 565.40 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enyl N-methylcarbamate |
| SMILES | CCCCC[C@@H](C=C[C@@H]1[C@@H](CC=CCCCCOC(=O)NC)[C@@H](O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C32H55NO7/c1-3-4-8-15-25(39-30-17-10-13-21-36-30)19-20-27-26(16-9-6-5-7-12-23-38-32(35)33-2)28(34)24-29(27)40-31-18-11-14-22-37-31/h6,9,19-20,25-31,34H,3-5,7-8,10-18,21-24H2,1-2H3,(H,33,35)/t25-,26+,27+,28-,29+,30?,31?/m0/s1 |
| InChIKey | LYEHQXCXIZZQBC-UZLKKCGHSA-N |
| XLogP | 6.42 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.79 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|