C24H40O7 — CID 173451889
2-[5-hydroxy-2-[6-methoxy-3-(oxan-2-yloxy)hex-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]acetaldehyde (PubChem CID 173451889) has the molecular formula C24H40O7 and a molecular weight of 440.58 g/mol. Its IUPAC name is 2-[5-hydroxy-2-[6-methoxy-3-(oxan-2-yloxy)hex-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]acetaldehyde.
| Compound Name | 2-[5-hydroxy-2-[6-methoxy-3-(oxan-2-yloxy)hex-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 173451889 |
| Molecular Formula | C24H40O7 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 2-[5-hydroxy-2-[6-methoxy-3-(oxan-2-yloxy)hex-1-enyl]-3-(oxan-2-yloxy)cyclopentyl]acetaldehyde |
| SMILES | COCCCC(C=CC1C(OC2CCCCO2)CC(O)C1CC=O)OC1CCCCO1 |
| InChI | InChI=1S/C24H40O7/c1-27-14-6-7-18(30-23-8-2-4-15-28-23)10-11-20-19(12-13-25)21(26)17-22(20)31-24-9-3-5-16-29-24/h10-11,13,18-24,26H,2-9,12,14-17H2,1H3 |
| InChIKey | CEYURMLUSDTDAG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|