C35H58O8 — CID 22827804
1-[(1R,2R,3R,5S)-2-[(3S)-3-cyclopentyl-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-7-(oxan-2-yloxy)heptan-2-one (PubChem CID 22827804) has the molecular formula C35H58O8 and a molecular weight of 606.84 g/mol. Its IUPAC name is 1-[(1R,2R,3R,5S)-2-[(3S)-3-cyclopentyl-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-7-(oxan-2-yloxy)heptan-2-one.
| Compound Name | 1-[(1R,2R,3R,5S)-2-[(3S)-3-cyclopentyl-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-7-(oxan-2-yloxy)heptan-2-one |
|---|---|
| PubChem CID | 22827804 |
| Molecular Formula | C35H58O8 |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 606.41 |
| IUPAC Name | 1-[(1R,2R,3R,5S)-2-[(3S)-3-cyclopentyl-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-7-(oxan-2-yloxy)heptan-2-one |
| SMILES | O=C(CCCCCOC1CCCCO1)C[C@@H]1[C@@H](C=C[C@@H](OC2CCCCO2)C2CCCC2)[C@H](OC2CCCCO2)C[C@@H]1O |
| InChI | InChI=1S/C35H58O8/c36-27(14-2-1-8-20-38-33-15-5-9-21-39-33)24-29-28(32(25-30(29)37)43-35-17-7-11-23-41-35)18-19-31(26-12-3-4-13-26)42-34-16-6-10-22-40-34/h18-19,26,28-35,37H,1-17,20-25H2/t28-,29-,30+,31-,32-,33?,34?,35?/m1/s1 |
| InChIKey | QNEGDGLBNWTQPP-ASBLSXQKSA-N |
| XLogP | 6.62 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|