C33H54O7 — CID 70566987
(E)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-(1-butylcyclobutyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-2-enoic acid (PubChem CID 70566987) has the molecular formula C33H54O7 and a molecular weight of 562.79 g/mol. Its IUPAC name is (E)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-(1-butylcyclobutyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-2-enoic acid.
| Compound Name | (E)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-(1-butylcyclobutyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 70566987 |
| Molecular Formula | C33H54O7 |
| Molecular Weight | 562.79 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | (E)-7-[(1R,2R,3R,5S)-2-[(E,3R)-3-(1-butylcyclobutyl)-3-(oxan-2-yloxy)prop-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]hept-2-enoic acid |
| SMILES | CCCCC1([C@@H](/C=C/[C@@H]2[C@@H](CCCC/C=C/C(=O)O)[C@@H](O)C[C@H]2OC2CCCCO2)OC2CCCCO2)CCC1 |
| InChI | InChI=1S/C33H54O7/c1-2-3-19-33(20-12-21-33)29(40-32-16-9-11-23-38-32)18-17-26-25(13-6-4-5-7-14-30(35)36)27(34)24-28(26)39-31-15-8-10-22-37-31/h7,14,17-18,25-29,31-32,34H,2-6,8-13,15-16,19-24H2,1H3,(H,35,36)/b14-7+,18-17+/t25-,26-,27+,28-,29-,31?,32?/m1/s1 |
| InChIKey | NYXSXURWFGANPD-QMDUHXFWSA-N |
| XLogP | 6.92 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.79 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|