C32H54O7 — CID 22816533
7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-3-(3-propylcyclobutyl)prop-1-enyl]cyclopentyl]heptanoic acid (PubChem CID 22816533) has the molecular formula C32H54O7 and a molecular weight of 550.78 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-3-(3-propylcyclobutyl)prop-1-enyl]cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-3-(3-propylcyclobutyl)prop-1-enyl]cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22816533 |
| Molecular Formula | C32H54O7 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.39 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-5-hydroxy-3-(oxan-2-yloxy)-2-[(3S)-3-(oxan-2-yloxy)-3-(3-propylcyclobutyl)prop-1-enyl]cyclopentyl]heptanoic acid |
| SMILES | CCCC1CC([C@@H](C=C[C@@H]2[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]2OC2CCCCO2)OC2CCCCO2)C1 |
| InChI | InChI=1S/C32H54O7/c1-2-11-23-20-24(21-23)28(38-31-14-7-9-18-36-31)17-16-26-25(12-5-3-4-6-13-30(34)35)27(33)22-29(26)39-32-15-8-10-19-37-32/h16-17,23-29,31-33H,2-15,18-22H2,1H3,(H,34,35)/t23?,24?,25-,26-,27+,28-,29-,31?,32?/m1/s1 |
| InChIKey | KFGVIOHBMASMGH-IFQNANKDSA-N |
| XLogP | 6.61 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|