C29H47ClO7 — CID 70633708
7-[(1S,2S,3S,5R)-2-(7-chloro-3-oxohept-1-enyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]heptanoic acid (PubChem CID 70633708) has the molecular formula C29H47ClO7 and a molecular weight of 543.14 g/mol. Its IUPAC name is 7-[(1S,2S,3S,5R)-2-(7-chloro-3-oxohept-1-enyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]heptanoic acid.
| Compound Name | 7-[(1S,2S,3S,5R)-2-(7-chloro-3-oxohept-1-enyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 70633708 |
| Molecular Formula | C29H47ClO7 |
| Molecular Weight | 543.14 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | 7-[(1S,2S,3S,5R)-2-(7-chloro-3-oxohept-1-enyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]heptanoic acid |
| SMILES | O=C(O)CCCCCC[C@H]1[C@H](C=CC(=O)CCCCCl)[C@@H](OC2CCCCO2)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C29H47ClO7/c30-18-8-5-11-22(31)16-17-24-23(12-3-1-2-4-13-27(32)33)25(36-28-14-6-9-19-34-28)21-26(24)37-29-15-7-10-20-35-29/h16-17,23-26,28-29H,1-15,18-21H2,(H,32,33)/t23-,24-,25+,26-,28?,29?/m0/s1 |
| InChIKey | JFYQXIVYIYYDHF-VDUHXNNJSA-N |
| XLogP | 6.41 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.14 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|