C32H55ClO6Si — CID 68937628
7-[(1R,2S,3R,5S)-2-[(7R)-8-[tert-butyl(dimethyl)silyl]oxy-7-methyl-3-oxooct-1-enyl]-5-chloro-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 68937628) has the molecular formula C32H55ClO6Si and a molecular weight of 599.33 g/mol. Its IUPAC name is 7-[(1R,2S,3R,5S)-2-[(7R)-8-[tert-butyl(dimethyl)silyl]oxy-7-methyl-3-oxooct-1-enyl]-5-chloro-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3R,5S)-2-[(7R)-8-[tert-butyl(dimethyl)silyl]oxy-7-methyl-3-oxooct-1-enyl]-5-chloro-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 68937628 |
| Molecular Formula | C32H55ClO6Si |
| Molecular Weight | 599.33 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | 7-[(1R,2S,3R,5S)-2-[(7R)-8-[tert-butyl(dimethyl)silyl]oxy-7-methyl-3-oxooct-1-enyl]-5-chloro-3-(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | C[C@H](CCCC(=O)C=C[C@H]1[C@@H](CC=CCCCC(=O)O)[C@@H](Cl)C[C@H]1OC1CCCCO1)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H55ClO6Si/c1-24(23-38-40(5,6)32(2,3)4)14-13-15-25(34)19-20-27-26(16-9-7-8-10-17-30(35)36)28(33)22-29(27)39-31-18-11-12-21-37-31/h7,9,19-20,24,26-29,31H,8,10-18,21-23H2,1-6H3,(H,35,36)/t24-,26-,27+,28+,29-,31?/m1/s1 |
| InChIKey | HEPUWWXVLFZGTE-CTADDWOWSA-N |
| XLogP | 8.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.33 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|