C37H59IO7SSi — CID 10147316
(Z)-7-[(1S,2S,3S,5R)-2-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-iodothiophen-2-yl)pent-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid (PubChem CID 10147316) has the molecular formula C37H59IO7SSi and a molecular weight of 802.93 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3S,5R)-2-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-iodothiophen-2-yl)pent-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,3S,5R)-2-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-iodothiophen-2-yl)pent-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10147316 |
| Molecular Formula | C37H59IO7SSi |
| Molecular Weight | 802.93 g/mol |
| Exact Mass | 802.28 |
| IUPAC Name | (Z)-7-[(1S,2S,3S,5R)-2-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-iodothiophen-2-yl)pent-1-enyl]-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/[C@H]1[C@H](C/C=C\CCCC(=O)O)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1)CCc1ccc(I)s1 |
| InChI | InChI=1S/C37H59IO7SSi/c1-37(2,3)47(4,5)45-27(18-20-28-21-23-33(38)46-28)19-22-30-29(14-8-6-7-9-15-34(39)40)31(43-35-16-10-12-24-41-35)26-32(30)44-36-17-11-13-25-42-36/h6,8,19,21-23,27,29-32,35-36H,7,9-18,20,24-26H2,1-5H3,(H,39,40)/b8-6-,22-19+/t27-,29+,30+,31-,32+,35?,36?/m1/s1 |
| InChIKey | PXZVNXSMRZGZJG-WNXYBFTQSA-N |
| XLogP | 9.89 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.93 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|