C42H76O5Si3 — CID 140538305
methyl (Z)-7-[(1R,2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 140538305) has the molecular formula C42H76O5Si3 and a molecular weight of 745.32 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 140538305 |
| Molecular Formula | C42H76O5Si3 |
| Molecular Weight | 745.32 g/mol |
| Exact Mass | 744.50 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C(O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1/C=C/[C@H](CCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C42H76O5Si3/c1-40(2,3)48(11,12)45-34(29-28-33-24-20-19-21-25-33)30-31-36-35(26-22-17-18-23-27-39(43)44-10)37(46-49(13,14)41(4,5)6)32-38(36)47-50(15,16)42(7,8)9/h17,19-22,24-25,30-31,34-38H,18,23,26-29,32H2,1-16H3/b22-17-,31-30+/t34-,35+,36+,37?,38-/m0/s1 |
| InChIKey | WVNNZXPRLHWEMR-KPUZARRNSA-N |
| XLogP | 12.27 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.32 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|