C36H68O5Si2 — CID 90791084
methyl 7-[(1R,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxy-4-(1-propylcyclobutyl)but-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate (PubChem CID 90791084) has the molecular formula C36H68O5Si2 and a molecular weight of 637.11 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxy-4-(1-propylcyclobutyl)but-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxy-4-(1-propylcyclobutyl)but-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90791084 |
| Molecular Formula | C36H68O5Si2 |
| Molecular Weight | 637.11 g/mol |
| Exact Mass | 636.46 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[4-[tert-butyl(dimethyl)silyl]oxy-4-(1-propylcyclobutyl)but-1-enyl]-5-hydroxycyclopentyl]hept-5-enoate |
| SMILES | CCCC1(C(CC=C[C@@H]2[C@@H](CC=CCCCC(=O)OC)[C@H](O)C[C@H]2O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C36H68O5Si2/c1-13-24-36(25-19-26-36)32(41-43(11,12)35(5,6)7)22-18-21-29-28(20-16-14-15-17-23-33(38)39-8)30(37)27-31(29)40-42(9,10)34(2,3)4/h14,16,18,21,28-32,37H,13,15,17,19-20,22-27H2,1-12H3/t28-,29-,30-,31-,32?/m1/s1 |
| InChIKey | KIXUJFKAPQJTHX-FTTFCUNYSA-N |
| XLogP | 9.97 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.11 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|