C24H37NO4 — CID 67244027
methyl (E)-7-[(1S,2R,3R,5R)-5-cyano-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate (PubChem CID 67244027) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is methyl (E)-7-[(1S,2R,3R,5R)-5-cyano-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (E)-7-[(1S,2R,3R,5R)-5-cyano-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 67244027 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | methyl (E)-7-[(1S,2R,3R,5R)-5-cyano-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoate |
| SMILES | CCC1(C(O)C/C=C/[C@@H]2[C@@H](C/C=C/CCCC(=O)OC)[C@H](C#N)C[C@H]2O)CCC1 |
| InChI | InChI=1S/C24H37NO4/c1-3-24(14-9-15-24)22(27)12-8-11-20-19(18(17-25)16-21(20)26)10-6-4-5-7-13-23(28)29-2/h4,6,8,11,18-22,26-27H,3,5,7,9-10,12-16H2,1-2H3/b6-4+,11-8+/t18-,19-,20+,21+,22?/m0/s1 |
| InChIKey | SRPNVXOAFZSLGJ-MIGHXNCFSA-N |
| XLogP | 4.30 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|